propan-2-yl 2,2-dichloro-3-methylbutanoate

C8H14Cl2O2 — CID 57232967

IUPACpropan-2-yl 2,2-dichloro-3-methylbutanoate
SMILESCC(C)OC(=O)C(Cl)(Cl)C(C)C
InChIInChI=1S/C8H14Cl2O2/c1-5(2)8(9,10)7(11)12-6(3)4/h5-6H,1-4H3
InChIKeyCHKSXUPYXOFMKF-UHFFFAOYSA-N
MW213.10 g/mol
LogP2.77
Rot. Bonds3

About propan-2-yl 2,2-dichloro-3-methylbutanoate

propan-2-yl 2,2-dichloro-3-methylbutanoate (PubChem CID 57232967) has the molecular formula C8H14Cl2O2 and a molecular weight of 213.10 g/mol. Its IUPAC name is propan-2-yl 2,2-dichloro-3-methylbutanoate.

Molecular Properties

Compound Namepropan-2-yl 2,2-dichloro-3-methylbutanoate
PubChem CID57232967
Molecular FormulaC8H14Cl2O2
Molecular Weight213.10 g/mol
Exact Mass212.04
IUPAC Namepropan-2-yl 2,2-dichloro-3-methylbutanoate
SMILESCC(C)OC(=O)C(Cl)(Cl)C(C)C
InChIInChI=1S/C8H14Cl2O2/c1-5(2)8(9,10)7(11)12-6(3)4/h5-6H,1-4H3
InChIKeyCHKSXUPYXOFMKF-UHFFFAOYSA-N
XLogP2.77
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.10
LogP ≤ 52.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze propan-2-yl 2,2-dichloro-3-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

dipropan-2-yl 2,2-dichloro-3-hydroxybutanedioate
CID 139631018
propan-2-yl 3,4-dimethyl-2,2,3-tri(propan-2-yl)pentanoate
CID 173451742
propan-2-yl 2-chloro-2,2-difluoroacetate
CID 14008863
propan-2-yl 2-amino-2,3-dimethylbutanoate
CID 18780772
dipropan-2-yl 2,3-dimethoxy-2,3-dimethylbutanedioate
CID 139989252
propan-2-yl 2-ethyl-2,3-dimethylbutanoate
CID 87568455
propan-2-yl 2,2,2-tribromoacetate
CID 6432844
propan-2-yl 2-acetyl-3-methyl-2-propan-2-ylbutanoate
CID 175223520
propan-2-yl 2-amino-2-sulfanylpropanoate
CID 123998994
methane;propan-2-yl 2-methyl-2-(methylamino)propanoate
CID 167683486
2-hydroxy-2-methylpropanoic acid;propan-2-ol;propan-2-yl 2-hydroxy-2-methylpropanoate
CID 159782312
propan-2-yl 2-amino-3,3,3-trifluoro-2-methylpropanoate
CID 79798173

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2,2-dichloro-3-methylbutanoate?
The IUPAC name of propan-2-yl 2,2-dichloro-3-methylbutanoate (CID 57232967) is propan-2-yl 2,2-dichloro-3-methylbutanoate.
What is the SMILES notation for propan-2-yl 2,2-dichloro-3-methylbutanoate?
The canonical SMILES for propan-2-yl 2,2-dichloro-3-methylbutanoate is CC(C)OC(=O)C(Cl)(Cl)C(C)C.
What is the InChIKey of propan-2-yl 2,2-dichloro-3-methylbutanoate?
The InChIKey is CHKSXUPYXOFMKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14Cl2O2/c1-5(2)8(9,10)7(11)12-6(3)4/h5-6H,1-4H3.
What are the key properties of propan-2-yl 2,2-dichloro-3-methylbutanoate?
propan-2-yl 2,2-dichloro-3-methylbutanoate has a molecular weight of 213.10 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2,2-dichloro-3-methylbutanoate is sourced from PubChem (CID 57232967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).