C10H20Cl3O4P — CID 51682652
(1S)-1-[[(2S)-butan-2-yl]oxy-[(2R)-butan-2-yl]oxyphosphoryl]-2,2,2-trichloroethanol (PubChem CID 51682652) has the molecular formula C10H20Cl3O4P and a molecular weight of 341.60 g/mol. Its IUPAC name is (1S)-1-[[(2S)-butan-2-yl]oxy-[(2R)-butan-2-yl]oxyphosphoryl]-2,2,2-trichloroethanol.
| Compound Name | (1S)-1-[[(2S)-butan-2-yl]oxy-[(2R)-butan-2-yl]oxyphosphoryl]-2,2,2-trichloroethanol |
|---|---|
| PubChem CID | 51682652 |
| Molecular Formula | C10H20Cl3O4P |
| Molecular Weight | 341.60 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | (1S)-1-[[(2S)-butan-2-yl]oxy-[(2R)-butan-2-yl]oxyphosphoryl]-2,2,2-trichloroethanol |
| SMILES | CC[C@@H](C)OP(=O)(O[C@@H](C)CC)[C@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H20Cl3O4P/c1-5-7(3)16-18(15,17-8(4)6-2)9(14)10(11,12)13/h7-9,14H,5-6H2,1-4H3/t7-,8+,9-,18?/m0/s1 |
| InChIKey | YNPDVDFFTXYYSL-OLSDJUHJSA-N |
| XLogP | 4.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|