C20H41N2O4+ — CID 149204279
[4-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethoxy]-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium (PubChem CID 149204279) has the molecular formula C20H41N2O4+ and a molecular weight of 373.56 g/mol. Its IUPAC name is [4-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethoxy]-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium.
| Compound Name | [4-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethoxy]-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium |
|---|---|
| PubChem CID | 149204279 |
| Molecular Formula | C20H41N2O4+ |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.31 |
| IUPAC Name | [4-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethoxy]-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium |
| SMILES | CC1(C)CC(OCCOC2CC(C)(C)N([OH2+])C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C20H40N2O4/c1-17(2)11-15(12-18(3,4)21(17)23)25-9-10-26-16-13-19(5,6)22(24)20(7,8)14-16/h15-16,23-24H,9-14H2,1-8H3/p+1 |
| InChIKey | XFHITGQGSPDENT-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 68.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|