C16H33NO5 — CID 160526152
1-hydroxy-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,2,6,6-tetramethylpiperidine (PubChem CID 160526152) has the molecular formula C16H33NO5 and a molecular weight of 319.44 g/mol. Its IUPAC name is 1-hydroxy-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-hydroxy-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 160526152 |
| Molecular Formula | C16H33NO5 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 1-hydroxy-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,2,6,6-tetramethylpiperidine |
| SMILES | COCCOCCOCCOC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C16H33NO5/c1-15(2)12-14(13-16(3,4)17(15)18)22-11-10-21-9-8-20-7-6-19-5/h14,18H,6-13H2,1-5H3 |
| InChIKey | OHAMPGKEPFVRQG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|