C13H27NO5 — CID 104567705
[1-amino-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]cyclopentyl]methanol (PubChem CID 104567705) has the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. Its IUPAC name is [1-amino-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]cyclopentyl]methanol.
| Compound Name | [1-amino-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]cyclopentyl]methanol |
|---|---|
| PubChem CID | 104567705 |
| Molecular Formula | C13H27NO5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | [1-amino-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]cyclopentyl]methanol |
| SMILES | COCCOCCOCCOC1CCC(N)(CO)C1 |
| InChI | InChI=1S/C13H27NO5/c1-16-4-5-17-6-7-18-8-9-19-12-2-3-13(14,10-12)11-15/h12,15H,2-11,14H2,1H3 |
| InChIKey | HURSZDIUDFSMHF-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|