C10H19NO4 — CID 79648903
3-(2-methoxyethoxy)-1-(methylamino)cyclopentane-1-carboxylic acid (PubChem CID 79648903) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)-1-(methylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(2-methoxyethoxy)-1-(methylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 79648903 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-(2-methoxyethoxy)-1-(methylamino)cyclopentane-1-carboxylic acid |
| SMILES | CNC1(C(=O)O)CCC(OCCOC)C1 |
| InChI | InChI=1S/C10H19NO4/c1-11-10(9(12)13)4-3-8(7-10)15-6-5-14-2/h8,11H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | OOUDIZXPFMCMAK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|