C13H26N2O2 — CID 79649123
1-(methylamino)-3-(4-methylpentoxy)cyclopentane-1-carboxamide (PubChem CID 79649123) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-(methylamino)-3-(4-methylpentoxy)cyclopentane-1-carboxamide.
| Compound Name | 1-(methylamino)-3-(4-methylpentoxy)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79649123 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-(methylamino)-3-(4-methylpentoxy)cyclopentane-1-carboxamide |
| SMILES | CNC1(C(N)=O)CCC(OCCCC(C)C)C1 |
| InChI | InChI=1S/C13H26N2O2/c1-10(2)5-4-8-17-11-6-7-13(9-11,15-3)12(14)16/h10-11,15H,4-9H2,1-3H3,(H2,14,16) |
| InChIKey | GXZBRZJHAPRRCK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|