C11H19F3N2O2 — CID 82791692
1-(methylamino)-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide (PubChem CID 82791692) has the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-(methylamino)-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide.
| Compound Name | 1-(methylamino)-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 82791692 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(methylamino)-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide |
| SMILES | CNC1(C(N)=O)CCC(OCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H19F3N2O2/c1-16-10(9(15)17)5-3-8(7-10)18-6-2-4-11(12,13)14/h8,16H,2-7H2,1H3,(H2,15,17) |
| InChIKey | AMHHEMQSHDGTNY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|