C13H24F3NO2 — CID 82793798
[1-(propan-2-ylamino)-3-(4,4,4-trifluorobutoxy)cyclopentyl]methanol (PubChem CID 82793798) has the molecular formula C13H24F3NO2 and a molecular weight of 283.33 g/mol. Its IUPAC name is [1-(propan-2-ylamino)-3-(4,4,4-trifluorobutoxy)cyclopentyl]methanol.
| Compound Name | [1-(propan-2-ylamino)-3-(4,4,4-trifluorobutoxy)cyclopentyl]methanol |
|---|---|
| PubChem CID | 82793798 |
| Molecular Formula | C13H24F3NO2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | [1-(propan-2-ylamino)-3-(4,4,4-trifluorobutoxy)cyclopentyl]methanol |
| SMILES | CC(C)NC1(CO)CCC(OCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C13H24F3NO2/c1-10(2)17-12(9-18)6-4-11(8-12)19-7-3-5-13(14,15)16/h10-11,17-18H,3-9H2,1-2H3 |
| InChIKey | GVRRLRIANZALNA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|