C15H31NO2 — CID 79640739
[3-(2-methylbutan-2-yloxy)-1-(propan-2-ylamino)cyclohexyl]methanol (PubChem CID 79640739) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is [3-(2-methylbutan-2-yloxy)-1-(propan-2-ylamino)cyclohexyl]methanol.
| Compound Name | [3-(2-methylbutan-2-yloxy)-1-(propan-2-ylamino)cyclohexyl]methanol |
|---|---|
| PubChem CID | 79640739 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | [3-(2-methylbutan-2-yloxy)-1-(propan-2-ylamino)cyclohexyl]methanol |
| SMILES | CCC(C)(C)OC1CCCC(CO)(NC(C)C)C1 |
| InChI | InChI=1S/C15H31NO2/c1-6-14(4,5)18-13-8-7-9-15(10-13,11-17)16-12(2)3/h12-13,16-17H,6-11H2,1-5H3 |
| InChIKey | JHGXOQVAOLMPMY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |