C13H25NO3 — CID 79638001
methyl 1-amino-3-(2-methylbutan-2-yloxy)cyclohexane-1-carboxylate (PubChem CID 79638001) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is methyl 1-amino-3-(2-methylbutan-2-yloxy)cyclohexane-1-carboxylate.
| Compound Name | methyl 1-amino-3-(2-methylbutan-2-yloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 79638001 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | methyl 1-amino-3-(2-methylbutan-2-yloxy)cyclohexane-1-carboxylate |
| SMILES | CCC(C)(C)OC1CCCC(N)(C(=O)OC)C1 |
| InChI | InChI=1S/C13H25NO3/c1-5-12(2,3)17-10-7-6-8-13(14,9-10)11(15)16-4/h10H,5-9,14H2,1-4H3 |
| InChIKey | PWVMBQGUJAPRAN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |