C14H27NO3 — CID 79648432
ethyl 1-(methylamino)-3-(2-methylbutan-2-yloxy)cyclopentane-1-carboxylate (PubChem CID 79648432) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is ethyl 1-(methylamino)-3-(2-methylbutan-2-yloxy)cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-(methylamino)-3-(2-methylbutan-2-yloxy)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79648432 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | ethyl 1-(methylamino)-3-(2-methylbutan-2-yloxy)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC)CCC(OC(C)(C)CC)C1 |
| InChI | InChI=1S/C14H27NO3/c1-6-13(3,4)18-11-8-9-14(10-11,15-5)12(16)17-7-2/h11,15H,6-10H2,1-5H3 |
| InChIKey | LRSDXSICRQHNOT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |