C15H27NO3 — CID 79648737
methyl 1-(cyclopropylamino)-3-(2-methylbutan-2-yloxy)cyclopentane-1-carboxylate (PubChem CID 79648737) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is methyl 1-(cyclopropylamino)-3-(2-methylbutan-2-yloxy)cyclopentane-1-carboxylate.
| Compound Name | methyl 1-(cyclopropylamino)-3-(2-methylbutan-2-yloxy)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79648737 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | methyl 1-(cyclopropylamino)-3-(2-methylbutan-2-yloxy)cyclopentane-1-carboxylate |
| SMILES | CCC(C)(C)OC1CCC(NC2CC2)(C(=O)OC)C1 |
| InChI | InChI=1S/C15H27NO3/c1-5-14(2,3)19-12-8-9-15(10-12,13(17)18-4)16-11-6-7-11/h11-12,16H,5-10H2,1-4H3 |
| InChIKey | RIDYCVKJCTZDNH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |