C15H29NO3 — CID 79649126
methyl 3-(2-methylbutan-2-yloxy)-1-(propylamino)cyclopentane-1-carboxylate (PubChem CID 79649126) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is methyl 3-(2-methylbutan-2-yloxy)-1-(propylamino)cyclopentane-1-carboxylate.
| Compound Name | methyl 3-(2-methylbutan-2-yloxy)-1-(propylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79649126 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | methyl 3-(2-methylbutan-2-yloxy)-1-(propylamino)cyclopentane-1-carboxylate |
| SMILES | CCCNC1(C(=O)OC)CCC(OC(C)(C)CC)C1 |
| InChI | InChI=1S/C15H29NO3/c1-6-10-16-15(13(17)18-5)9-8-12(11-15)19-14(3,4)7-2/h12,16H,6-11H2,1-5H3 |
| InChIKey | FLVREULMPACRIB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |