C17H31NO3 — CID 79644428
methyl 3-(cyclohexylmethoxy)-1-(propylamino)cyclopentane-1-carboxylate (PubChem CID 79644428) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is methyl 3-(cyclohexylmethoxy)-1-(propylamino)cyclopentane-1-carboxylate.
| Compound Name | methyl 3-(cyclohexylmethoxy)-1-(propylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79644428 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | methyl 3-(cyclohexylmethoxy)-1-(propylamino)cyclopentane-1-carboxylate |
| SMILES | CCCNC1(C(=O)OC)CCC(OCC2CCCCC2)C1 |
| InChI | InChI=1S/C17H31NO3/c1-3-11-18-17(16(19)20-2)10-9-15(12-17)21-13-14-7-5-4-6-8-14/h14-15,18H,3-13H2,1-2H3 |
| InChIKey | DMHMQURSNYTXKZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |