C14H29NO5 — CID 104567715
[1-amino-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]cyclohexyl]methanol (PubChem CID 104567715) has the molecular formula C14H29NO5 and a molecular weight of 291.39 g/mol. Its IUPAC name is [1-amino-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]cyclohexyl]methanol.
| Compound Name | [1-amino-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]cyclohexyl]methanol |
|---|---|
| PubChem CID | 104567715 |
| Molecular Formula | C14H29NO5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | [1-amino-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]cyclohexyl]methanol |
| SMILES | COCCOCCOCCOC1CCCC(N)(CO)C1 |
| InChI | InChI=1S/C14H29NO5/c1-17-5-6-18-7-8-19-9-10-20-13-3-2-4-14(15,11-13)12-16/h13,16H,2-12,15H2,1H3 |
| InChIKey | FVZRPSNVBZCZNM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|