C18H36NO6 — CID 102491560
CID 102491560 (PubChem CID 102491560) has the molecular formula C18H36NO6 and a molecular weight of 362.49 g/mol.
| Compound Name | CID 102491560 |
|---|---|
| PubChem CID | 102491560 |
| Molecular Formula | C18H36NO6 |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | — |
| SMILES | COCCOCCOCCOCCOC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C18H36NO6/c1-17(2)14-16(15-18(3,4)19(17)20)25-13-12-24-11-10-23-9-8-22-7-6-21-5/h16H,6-15H2,1-5H3 |
| InChIKey | KUZVIIQVMHLJKC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|