C29H53N4O4+ — CID 11592494
CID 11592494 (PubChem CID 11592494) has the molecular formula C29H53N4O4+ and a molecular weight of 521.77 g/mol.
| Compound Name | CID 11592494 |
|---|---|
| PubChem CID | 11592494 |
| Molecular Formula | C29H53N4O4+ |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.41 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OCCCCn2cc[n+](CCCCOC3CC(C)(C)N([O])C(C)(C)C3)c2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C29H53N4O4/c1-26(2)19-24(20-27(3,4)32(26)34)36-17-11-9-13-30-15-16-31(23-30)14-10-12-18-37-25-21-28(5,6)33(35)29(7,8)22-25/h15-16,23-25H,9-14,17-22H2,1-8H3/q+1 |
| InChIKey | AQADXGBGNSRPOW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|