C25H41N4O6+ — CID 166570481
CID 166570481 (PubChem CID 166570481) has the molecular formula C25H41N4O6+ and a molecular weight of 493.63 g/mol.
| Compound Name | CID 166570481 |
|---|---|
| PubChem CID | 166570481 |
| Molecular Formula | C25H41N4O6+ |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OC(=O)Cn2cc[n+](CC(=O)OC3CC(C)(C)N([O])C(C)(C)C3)c2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C25H41N4O6/c1-22(2)11-18(12-23(3,4)28(22)32)34-20(30)15-26-9-10-27(17-26)16-21(31)35-19-13-24(5,6)29(33)25(7,8)14-19/h9-10,17-19H,11-16H2,1-8H3/q+1 |
| InChIKey | JALUCLJLONNVTN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 107.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|