C25H43N4O6+ — CID 166148916
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-[3-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2-oxoethyl]imidazol-3-ium-1-yl]acetate (PubChem CID 166148916) has the molecular formula C25H43N4O6+ and a molecular weight of 495.64 g/mol. Its IUPAC name is (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-[3-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2-oxoethyl]imidazol-3-ium-1-yl]acetate.
| Compound Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-[3-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2-oxoethyl]imidazol-3-ium-1-yl]acetate |
|---|---|
| PubChem CID | 166148916 |
| Molecular Formula | C25H43N4O6+ |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-[3-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2-oxoethyl]imidazol-3-ium-1-yl]acetate |
| SMILES | CC1(C)CC(OC(=O)Cn2cc[n+](CC(=O)OC3CC(C)(C)N(O)C(C)(C)C3)c2)CC(C)(C)N1O |
| InChI | InChI=1S/C25H43N4O6/c1-22(2)11-18(12-23(3,4)28(22)32)34-20(30)15-26-9-10-27(17-26)16-21(31)35-19-13-24(5,6)29(33)25(7,8)14-19/h9-10,17-19,32-33H,11-16H2,1-8H3/q+1 |
| InChIKey | GCBHWLOUBWRWMY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|