C22H42INO8 — CID 163668551
2-[2-[2-[2-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-iodopropanoate (PubChem CID 163668551) has the molecular formula C22H42INO8 and a molecular weight of 575.48 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-iodopropanoate.
| Compound Name | 2-[2-[2-[2-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-iodopropanoate |
|---|---|
| PubChem CID | 163668551 |
| Molecular Formula | C22H42INO8 |
| Molecular Weight | 575.48 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 2-[2-[2-[2-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-iodopropanoate |
| SMILES | CC(I)C(=O)OCCOCCOCCOCCOCCOC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C22H42INO8/c1-18(23)20(25)32-15-13-30-11-9-28-7-6-27-8-10-29-12-14-31-19-16-21(2,3)24(26)22(4,5)17-19/h18-19,26H,6-17H2,1-5H3 |
| InChIKey | HKCLWHGZQKVAGQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|