C9H18NO5P-2 — CID 140879136
(1-hydroxy-2,2,6-trimethyl-6-oxidopiperidin-4-yl)oxy-methylphosphinate (PubChem CID 140879136) has the molecular formula C9H18NO5P-2 and a molecular weight of 251.22 g/mol. Its IUPAC name is (1-hydroxy-2,2,6-trimethyl-6-oxidopiperidin-4-yl)oxy-methylphosphinate.
| Compound Name | (1-hydroxy-2,2,6-trimethyl-6-oxidopiperidin-4-yl)oxy-methylphosphinate |
|---|---|
| PubChem CID | 140879136 |
| Molecular Formula | C9H18NO5P-2 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (1-hydroxy-2,2,6-trimethyl-6-oxidopiperidin-4-yl)oxy-methylphosphinate |
| SMILES | CC1(C)CC(OP(C)(=O)[O-])CC(C)([O-])N1O |
| InChI | InChI=1S/C9H19NO5P/c1-8(2)5-7(15-16(4,13)14)6-9(3,11)10(8)12/h7,12H,5-6H2,1-4H3,(H,13,14)/q-1/p-1 |
| InChIKey | RYCTTYBUJJVSFT-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|