C10H21FNO3P — CID 22895108
4-[fluoro(methyl)phosphoryl]oxy-1-hydroxy-2,2,6,6-tetramethylpiperidine (PubChem CID 22895108) has the molecular formula C10H21FNO3P and a molecular weight of 253.25 g/mol. Its IUPAC name is 4-[fluoro(methyl)phosphoryl]oxy-1-hydroxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[fluoro(methyl)phosphoryl]oxy-1-hydroxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 22895108 |
| Molecular Formula | C10H21FNO3P |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-[fluoro(methyl)phosphoryl]oxy-1-hydroxy-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CC(OP(C)(=O)F)CC(C)(C)N1O |
| InChI | InChI=1S/C10H21FNO3P/c1-9(2)6-8(15-16(5,11)14)7-10(3,4)12(9)13/h8,13H,6-7H2,1-5H3 |
| InChIKey | NUXNONQXJRPPSN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|