C11H23NO5P- — CID 71297215
(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) methyl phosphate (PubChem CID 71297215) has the molecular formula C11H23NO5P- and a molecular weight of 280.28 g/mol. Its IUPAC name is (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) methyl phosphate.
| Compound Name | (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) methyl phosphate |
|---|---|
| PubChem CID | 71297215 |
| Molecular Formula | C11H23NO5P- |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) methyl phosphate |
| SMILES | CON1C(C)(C)CC(OP(=O)([O-])OC)CC1(C)C |
| InChI | InChI=1S/C11H24NO5P/c1-10(2)7-9(17-18(13,14)16-6)8-11(3,4)12(10)15-5/h9H,7-8H2,1-6H3,(H,13,14)/p-1 |
| InChIKey | RFPYLLNFNYTPIN-UHFFFAOYSA-M |
| XLogP | 1.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|