C8H17NO5S — CID 159900061
(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl) hydrogen sulfate (PubChem CID 159900061) has the molecular formula C8H17NO5S and a molecular weight of 239.29 g/mol. Its IUPAC name is (1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl) hydrogen sulfate.
| Compound Name | (1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 159900061 |
| Molecular Formula | C8H17NO5S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl) hydrogen sulfate |
| SMILES | CC1(C)CC(OS(=O)(=O)O)C(C)(C)N1O |
| InChI | InChI=1S/C8H17NO5S/c1-7(2)5-6(14-15(11,12)13)8(3,4)9(7)10/h6,10H,5H2,1-4H3,(H,11,12,13) |
| InChIKey | CVTQKOONMRROBF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|