C31H21NO3 — CID 20590965
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) docosa-2,4,6,8,10,12,14,16,18,20-decaynoate (PubChem CID 20590965) has the molecular formula C31H21NO3 and a molecular weight of 455.51 g/mol. Its IUPAC name is (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) docosa-2,4,6,8,10,12,14,16,18,20-decaynoate.
| Compound Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) docosa-2,4,6,8,10,12,14,16,18,20-decaynoate |
|---|---|
| PubChem CID | 20590965 |
| Molecular Formula | C31H21NO3 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) docosa-2,4,6,8,10,12,14,16,18,20-decaynoate |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC(=O)OC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C31H21NO3/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-29(33)35-28-26-30(2,3)32(34)31(4,5)27-28/h28,34H,26-27H2,1-5H3 |
| InChIKey | TZYQZFJCKKXWDT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|