C19H31NO4 — CID 23569650
[1-[2-[(E)-but-2-en-2-yl]peroxyethyl]-2,2,6,6-tetramethylpiperidin-4-yl] but-2-ynoate (PubChem CID 23569650) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is [1-[2-[(E)-but-2-en-2-yl]peroxyethyl]-2,2,6,6-tetramethylpiperidin-4-yl] but-2-ynoate.
| Compound Name | [1-[2-[(E)-but-2-en-2-yl]peroxyethyl]-2,2,6,6-tetramethylpiperidin-4-yl] but-2-ynoate |
|---|---|
| PubChem CID | 23569650 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | [1-[2-[(E)-but-2-en-2-yl]peroxyethyl]-2,2,6,6-tetramethylpiperidin-4-yl] but-2-ynoate |
| SMILES | CC#CC(=O)OC1CC(C)(C)N(CCOO/C(C)=C/C)C(C)(C)C1 |
| InChI | InChI=1S/C19H31NO4/c1-8-10-17(21)23-16-13-18(4,5)20(19(6,7)14-16)11-12-22-24-15(3)9-2/h9,16H,11-14H2,1-7H3/b15-9+ |
| InChIKey | PUOLRILTTSYWLU-OQLLNIDSSA-N |
| XLogP | 3.45 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|