C19H44N2O3 — CID 142932735
N,N-ditert-butylhydroxylamine;ethane;1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 142932735) has the molecular formula C19H44N2O3 and a molecular weight of 348.57 g/mol. Its IUPAC name is N,N-ditert-butylhydroxylamine;ethane;1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | N,N-ditert-butylhydroxylamine;ethane;1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 142932735 |
| Molecular Formula | C19H44N2O3 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.34 |
| IUPAC Name | N,N-ditert-butylhydroxylamine;ethane;1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC.CC(C)(C)N(O)C(C)(C)C.CC1(C)CC(O)CC(C)(C)N1O |
| InChI | InChI=1S/C9H19NO2.C8H19NO.C2H6/c1-8(2)5-7(11)6-9(3,4)10(8)12;1-7(2,3)9(10)8(4,5)6;1-2/h7,11-12H,5-6H2,1-4H3;10H,1-6H3;1-2H3 |
| InChIKey | PXTAJUPDRCCWHZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|