C18H38N4O2 — CID 129171446
1,1-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)hydrazine (PubChem CID 129171446) has the molecular formula C18H38N4O2 and a molecular weight of 342.53 g/mol. Its IUPAC name is 1,1-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)hydrazine.
| Compound Name | 1,1-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 129171446 |
| Molecular Formula | C18H38N4O2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | 1,1-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)hydrazine |
| SMILES | CC1(C)CC(N(N)C2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C18H38N4O2/c1-15(2)9-13(10-16(3,4)21(15)23)20(19)14-11-17(5,6)22(24)18(7,8)12-14/h13-14,23-24H,9-12,19H2,1-8H3 |
| InChIKey | GICCLRNIBTWRLP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|