C23H40N4O8 — CID 22892224
[formyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamoyl]oxymethyl N-formyl-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamate (PubChem CID 22892224) has the molecular formula C23H40N4O8 and a molecular weight of 500.59 g/mol. Its IUPAC name is [formyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamoyl]oxymethyl N-formyl-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamate.
| Compound Name | [formyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamoyl]oxymethyl N-formyl-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 22892224 |
| Molecular Formula | C23H40N4O8 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | [formyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamoyl]oxymethyl N-formyl-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamate |
| SMILES | CC1(C)CC(N(C=O)C(=O)OCOC(=O)N(C=O)C2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C23H40N4O8/c1-20(2)9-16(10-21(3,4)26(20)32)24(13-28)18(30)34-15-35-19(31)25(14-29)17-11-22(5,6)27(33)23(7,8)12-17/h13-14,16-17,32-33H,9-12,15H2,1-8H3 |
| InChIKey | IXBMACRORBIPPW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|