C11H19NO — CID 154315687
4-ethynyl-1-hydroxy-2,2,6,6-tetramethylpiperidine (PubChem CID 154315687) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-ethynyl-1-hydroxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-ethynyl-1-hydroxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 154315687 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-ethynyl-1-hydroxy-2,2,6,6-tetramethylpiperidine |
| SMILES | C#CC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C11H19NO/c1-6-9-7-10(2,3)12(13)11(4,5)8-9/h1,9,13H,7-8H2,2-5H3 |
| InChIKey | BZRRKGGCRQIREC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|