C10H18NNaO3 — CID 157333041
sodium 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate (PubChem CID 157333041) has the molecular formula C10H18NNaO3 and a molecular weight of 223.25 g/mol. Its IUPAC name is sodium 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate.
| Compound Name | sodium 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 157333041 |
| Molecular Formula | C10H18NNaO3 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | sodium 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate |
| SMILES | CC1(C)CC(C(=O)[O-])CC(C)(C)N1O.[Na+] |
| InChI | InChI=1S/C10H19NO3.Na/c1-9(2)5-7(8(12)13)6-10(3,4)11(9)14;/h7,14H,5-6H2,1-4H3,(H,12,13);/q;+1/p-1 |
| InChIKey | ATFBEZARSAMYAA-UHFFFAOYSA-M |
| XLogP | -2.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |