C24H41ClN2O3 — CID 87689920
N-(3,5-ditert-butyl-4-hydroxyphenyl)-1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxamide;hydron;chloride (PubChem CID 87689920) has the molecular formula C24H41ClN2O3 and a molecular weight of 441.06 g/mol. Its IUPAC name is N-(3,5-ditert-butyl-4-hydroxyphenyl)-1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxamide;hydron;chloride.
| Compound Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)-1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxamide;hydron;chloride |
|---|---|
| PubChem CID | 87689920 |
| Molecular Formula | C24H41ClN2O3 |
| Molecular Weight | 441.06 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)-1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxamide;hydron;chloride |
| SMILES | CC(C)(C)c1cc(NC(=O)C2CC(C)(C)N(O)C(C)(C)C2)cc(C(C)(C)C)c1O.[Cl-].[H+] |
| InChI | InChI=1S/C24H40N2O3.ClH/c1-21(2,3)17-11-16(12-18(19(17)27)22(4,5)6)25-20(28)15-13-23(7,8)26(29)24(9,10)14-15;/h11-12,15,27,29H,13-14H2,1-10H3,(H,25,28);1H |
| InChIKey | VOGZCHWDQDTDOJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.06 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|