C19H27NO4 — CID 21321063
4-(3,5-ditert-butyl-4-hydroxyanilino)-2-methylidene-4-oxobutanoic acid (PubChem CID 21321063) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-(3,5-ditert-butyl-4-hydroxyanilino)-2-methylidene-4-oxobutanoic acid.
| Compound Name | 4-(3,5-ditert-butyl-4-hydroxyanilino)-2-methylidene-4-oxobutanoic acid |
|---|---|
| PubChem CID | 21321063 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 4-(3,5-ditert-butyl-4-hydroxyanilino)-2-methylidene-4-oxobutanoic acid |
| SMILES | C=C(CC(=O)Nc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C19H27NO4/c1-11(17(23)24)8-15(21)20-12-9-13(18(2,3)4)16(22)14(10-12)19(5,6)7/h9-10,22H,1,8H2,2-7H3,(H,20,21)(H,23,24) |
| InChIKey | KDINQPUPKSWBHK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|