C19H29NO2 — CID 21321077
N-[3-tert-butyl-4-hydroxy-5-(2-methylpentan-2-yl)phenyl]prop-2-enamide (PubChem CID 21321077) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-[3-tert-butyl-4-hydroxy-5-(2-methylpentan-2-yl)phenyl]prop-2-enamide.
| Compound Name | N-[3-tert-butyl-4-hydroxy-5-(2-methylpentan-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 21321077 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-[3-tert-butyl-4-hydroxy-5-(2-methylpentan-2-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(C(C)(C)C)c(O)c(C(C)(C)CCC)c1 |
| InChI | InChI=1S/C19H29NO2/c1-8-10-19(6,7)15-12-13(20-16(21)9-2)11-14(17(15)22)18(3,4)5/h9,11-12,22H,2,8,10H2,1,3-7H3,(H,20,21) |
| InChIKey | JIOYPGYQBLRCCK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|