C18H28O3 — CID 19822805
3-tert-butyl-2-hydroxy-6-methyl-5-(2-methylpentan-2-yl)benzoic acid (PubChem CID 19822805) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-tert-butyl-2-hydroxy-6-methyl-5-(2-methylpentan-2-yl)benzoic acid.
| Compound Name | 3-tert-butyl-2-hydroxy-6-methyl-5-(2-methylpentan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 19822805 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 3-tert-butyl-2-hydroxy-6-methyl-5-(2-methylpentan-2-yl)benzoic acid |
| SMILES | CCCC(C)(C)c1cc(C(C)(C)C)c(O)c(C(=O)O)c1C |
| InChI | InChI=1S/C18H28O3/c1-8-9-18(6,7)12-10-13(17(3,4)5)15(19)14(11(12)2)16(20)21/h10,19H,8-9H2,1-7H3,(H,20,21) |
| InChIKey | HTGPZLIMMBYQOF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |