C27H44O3 — CID 87831386
2-[4-hydroxy-3,5-bis(2-methylheptan-2-yl)phenyl]ethyl prop-2-enoate (PubChem CID 87831386) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is 2-[4-hydroxy-3,5-bis(2-methylheptan-2-yl)phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-hydroxy-3,5-bis(2-methylheptan-2-yl)phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 87831386 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | 2-[4-hydroxy-3,5-bis(2-methylheptan-2-yl)phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1cc(C(C)(C)CCCCC)c(O)c(C(C)(C)CCCCC)c1 |
| InChI | InChI=1S/C27H44O3/c1-8-11-13-16-26(4,5)22-19-21(15-18-30-24(28)10-3)20-23(25(22)29)27(6,7)17-14-12-9-2/h10,19-20,29H,3,8-9,11-18H2,1-2,4-7H3 |
| InChIKey | VMLCURAQCQQMPV-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|