C22H34O4 — CID 88811774
2-[[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]methoxy]ethyl prop-2-enoate (PubChem CID 88811774) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-[[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]methoxy]ethyl prop-2-enoate.
| Compound Name | 2-[[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]methoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 88811774 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-[[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]methoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCc1cc(C(C)(C)CC)c(O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C22H34O4/c1-8-19(23)26-12-11-25-15-16-13-17(21(4,5)9-2)20(24)18(14-16)22(6,7)10-3/h8,13-14,24H,1,9-12,15H2,2-7H3 |
| InChIKey | TWWCDNURGYSGLF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|