C23H36O10 — CID 176764617
2-[2-[3-methyl-4-(2-prop-2-enoyloxyethoxy)-3-(2-prop-2-enoyloxyethoxymethyl)butoxy]ethoxy]ethyl prop-2-enoate (PubChem CID 176764617) has the molecular formula C23H36O10 and a molecular weight of 472.53 g/mol. Its IUPAC name is 2-[2-[3-methyl-4-(2-prop-2-enoyloxyethoxy)-3-(2-prop-2-enoyloxyethoxymethyl)butoxy]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[3-methyl-4-(2-prop-2-enoyloxyethoxy)-3-(2-prop-2-enoyloxyethoxymethyl)butoxy]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 176764617 |
| Molecular Formula | C23H36O10 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 2-[2-[3-methyl-4-(2-prop-2-enoyloxyethoxy)-3-(2-prop-2-enoyloxyethoxymethyl)butoxy]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOCCC(C)(COCCOC(=O)C=C)COCCOC(=O)C=C |
| InChI | InChI=1S/C23H36O10/c1-5-20(24)31-15-12-28-11-10-27-9-8-23(4,18-29-13-16-32-21(25)6-2)19-30-14-17-33-22(26)7-3/h5-7H,1-3,8-19H2,4H3 |
| InChIKey | MTWYPYZPJHGRHG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|