About N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide
N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide (PubChem CID 22754678) has the molecular formula C19H29NO3
and a molecular weight of 319.45 g/mol. Its IUPAC name is N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide |
| PubChem CID | 22754678 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCOCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H29NO3/c1-8-16(21)20-12-23-11-13-9-14(18(2,3)4)17(22)15(10-13)19(5,6)7/h8-10,22H,1,11-12H2,2-7H3,(H,20,21) |
| InChIKey | QLARJGZMKICHSE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide?
The IUPAC name of N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide (CID 22754678) is N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide.
What is the SMILES notation for N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide?
The canonical SMILES for N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide is C=CC(=O)NCOCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide?
The InChIKey is QLARJGZMKICHSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO3/c1-8-16(21)20-12-23-11-13-9-14(18(2,3)4)17(22)15(10-13)19(5,6)7/h8-10,22H,1,11-12H2,2-7H3,(H,20,21).
What are the key properties of N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide?
N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide has a molecular weight of 319.45 g/mol, XLogP of 3.76, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxymethyl]prop-2-enamide is sourced from PubChem (CID 22754678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).