C18H27NO2 — CID 21163605
N-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enamide (PubChem CID 21163605) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enamide.
| Compound Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 21163605 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H27NO2/c1-8-15(20)19-11-12-9-13(17(2,3)4)16(21)14(10-12)18(5,6)7/h8-10,21H,1,11H2,2-7H3,(H,19,20) |
| InChIKey | FICIMVBBIKUYAY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|