C22H30N2OS — CID 15620960
1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-phenylthiourea (PubChem CID 15620960) has the molecular formula C22H30N2OS and a molecular weight of 370.56 g/mol. Its IUPAC name is 1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-phenylthiourea.
| Compound Name | 1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 15620960 |
| Molecular Formula | C22H30N2OS |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-phenylthiourea |
| SMILES | CC(C)(C)c1cc(CNC(=S)Nc2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H30N2OS/c1-21(2,3)17-12-15(13-18(19(17)25)22(4,5)6)14-23-20(26)24-16-10-8-7-9-11-16/h7-13,25H,14H2,1-6H3,(H2,23,24,26) |
| InChIKey | FDINCDYSRJQMPI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|