C11H12N4S — CID 116507746
1-phenyl-3-(1H-pyrazol-4-ylmethyl)thiourea (PubChem CID 116507746) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is 1-phenyl-3-(1H-pyrazol-4-ylmethyl)thiourea.
| Compound Name | 1-phenyl-3-(1H-pyrazol-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 116507746 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-phenyl-3-(1H-pyrazol-4-ylmethyl)thiourea |
| SMILES | S=C(NCc1cn[nH]c1)Nc1ccccc1 |
| InChI | InChI=1S/C11H12N4S/c16-11(12-6-9-7-13-14-8-9)15-10-4-2-1-3-5-10/h1-5,7-8H,6H2,(H,13,14)(H2,12,15,16) |
| InChIKey | XPKUNNXZOWCRJO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|