C36H42N6S3 — CID 122215413
1-phenyl-3-[[2,4,6-triethyl-3,5-bis[(phenylcarbamothioylamino)methyl]phenyl]methyl]thiourea (PubChem CID 122215413) has the molecular formula C36H42N6S3 and a molecular weight of 654.98 g/mol. Its IUPAC name is 1-phenyl-3-[[2,4,6-triethyl-3,5-bis[(phenylcarbamothioylamino)methyl]phenyl]methyl]thiourea.
| Compound Name | 1-phenyl-3-[[2,4,6-triethyl-3,5-bis[(phenylcarbamothioylamino)methyl]phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 122215413 |
| Molecular Formula | C36H42N6S3 |
| Molecular Weight | 654.98 g/mol |
| Exact Mass | 654.26 |
| IUPAC Name | 1-phenyl-3-[[2,4,6-triethyl-3,5-bis[(phenylcarbamothioylamino)methyl]phenyl]methyl]thiourea |
| SMILES | CCc1c(CNC(=S)Nc2ccccc2)c(CC)c(CNC(=S)Nc2ccccc2)c(CC)c1CNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C36H42N6S3/c1-4-28-31(22-37-34(43)40-25-16-10-7-11-17-25)29(5-2)33(24-39-36(45)42-27-20-14-9-15-21-27)30(6-3)32(28)23-38-35(44)41-26-18-12-8-13-19-26/h7-21H,4-6,22-24H2,1-3H3,(H2,37,40,43)(H2,38,41,44)(H2,39,42,45) |
| InChIKey | DQVPYJCGBUSHPU-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.98 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|