C14H27NO2 — CID 89177334
2-[methyl(2-methylheptan-2-yl)amino]ethyl prop-2-enoate (PubChem CID 89177334) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 2-[methyl(2-methylheptan-2-yl)amino]ethyl prop-2-enoate.
| Compound Name | 2-[methyl(2-methylheptan-2-yl)amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 89177334 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 2-[methyl(2-methylheptan-2-yl)amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(C)C(C)(C)CCCCC |
| InChI | InChI=1S/C14H27NO2/c1-6-8-9-10-14(3,4)15(5)11-12-17-13(16)7-2/h7H,2,6,8-12H2,1,3-5H3 |
| InChIKey | LDOXDZPKLDKGMR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|