C14H20N2O4 — CID 13342238
2-aminoethanol;4-(4-methylanilino)-2-methylidene-4-oxobutanoic acid (PubChem CID 13342238) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-aminoethanol;4-(4-methylanilino)-2-methylidene-4-oxobutanoic acid.
| Compound Name | 2-aminoethanol;4-(4-methylanilino)-2-methylidene-4-oxobutanoic acid |
|---|---|
| PubChem CID | 13342238 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-aminoethanol;4-(4-methylanilino)-2-methylidene-4-oxobutanoic acid |
| SMILES | C=C(CC(=O)Nc1ccc(C)cc1)C(=O)O.NCCO |
| InChI | InChI=1S/C12H13NO3.C2H7NO/c1-8-3-5-10(6-4-8)13-11(14)7-9(2)12(15)16;3-1-2-4/h3-6H,2,7H2,1H3,(H,13,14)(H,15,16);4H,1-3H2 |
| InChIKey | FQOLPQXWGNMQDH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|