C17H16N2O3 — CID 19795358
4-(4-anilinoanilino)-2-methylidene-4-oxobutanoic acid (PubChem CID 19795358) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-(4-anilinoanilino)-2-methylidene-4-oxobutanoic acid.
| Compound Name | 4-(4-anilinoanilino)-2-methylidene-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19795358 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-(4-anilinoanilino)-2-methylidene-4-oxobutanoic acid |
| SMILES | C=C(CC(=O)Nc1ccc(Nc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C17H16N2O3/c1-12(17(21)22)11-16(20)19-15-9-7-14(8-10-15)18-13-5-3-2-4-6-13/h2-10,18H,1,11H2,(H,19,20)(H,21,22) |
| InChIKey | HYZXMTFLYUAPPN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|