C15H14N2O6 — CID 89164542
4-[4-[[(Z)-3-carboxyprop-2-enoyl]amino]anilino]-2-methylidene-4-oxobutanoic acid (PubChem CID 89164542) has the molecular formula C15H14N2O6 and a molecular weight of 318.29 g/mol. Its IUPAC name is 4-[4-[[(Z)-3-carboxyprop-2-enoyl]amino]anilino]-2-methylidene-4-oxobutanoic acid.
| Compound Name | 4-[4-[[(Z)-3-carboxyprop-2-enoyl]amino]anilino]-2-methylidene-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89164542 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-[4-[[(Z)-3-carboxyprop-2-enoyl]amino]anilino]-2-methylidene-4-oxobutanoic acid |
| SMILES | C=C(CC(=O)Nc1ccc(NC(=O)/C=C\C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C15H14N2O6/c1-9(15(22)23)8-13(19)17-11-4-2-10(3-5-11)16-12(18)6-7-14(20)21/h2-7H,1,8H2,(H,16,18)(H,17,19)(H,20,21)(H,22,23)/b7-6- |
| InChIKey | ZZORQNCPCOEDAU-SREVYHEPSA-N |
| XLogP | 1.24 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|