C23H22N4O3 — CID 4090382
N-(4-anilinophenyl)-3-[2-(2-hydroxybenzoyl)hydrazinyl]but-3-enamide (PubChem CID 4090382) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-(4-anilinophenyl)-3-[2-(2-hydroxybenzoyl)hydrazinyl]but-3-enamide.
| Compound Name | N-(4-anilinophenyl)-3-[2-(2-hydroxybenzoyl)hydrazinyl]but-3-enamide |
|---|---|
| PubChem CID | 4090382 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-(4-anilinophenyl)-3-[2-(2-hydroxybenzoyl)hydrazinyl]but-3-enamide |
| SMILES | C=C(CC(=O)Nc1ccc(Nc2ccccc2)cc1)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C23H22N4O3/c1-16(26-27-23(30)20-9-5-6-10-21(20)28)15-22(29)25-19-13-11-18(12-14-19)24-17-7-3-2-4-8-17/h2-14,24,26,28H,1,15H2,(H,25,29)(H,27,30) |
| InChIKey | ZUBROBXWVREEIJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|