C22H18BrN3O5 — CID 30156322
N-(4-bromophenyl)-2-[2-[[(2-hydroxybenzoyl)amino]carbamoyl]phenoxy]acetamide (PubChem CID 30156322) has the molecular formula C22H18BrN3O5 and a molecular weight of 484.31 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[2-[[(2-hydroxybenzoyl)amino]carbamoyl]phenoxy]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[2-[[(2-hydroxybenzoyl)amino]carbamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 30156322 |
| Molecular Formula | C22H18BrN3O5 |
| Molecular Weight | 484.31 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | N-(4-bromophenyl)-2-[2-[[(2-hydroxybenzoyl)amino]carbamoyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1C(=O)NNC(=O)c1ccccc1O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H18BrN3O5/c23-14-9-11-15(12-10-14)24-20(28)13-31-19-8-4-2-6-17(19)22(30)26-25-21(29)16-5-1-3-7-18(16)27/h1-12,27H,13H2,(H,24,28)(H,25,29)(H,26,30) |
| InChIKey | AUXWMTRIUJFSRO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|